About (2R)-2-amino-4,6-dioxopiperidine-2-carboxylic acid
(2R)-2-amino-4,6-dioxopiperidine-2-carboxylic acid (PubChem CID 70469114) has the molecular formula C6H8N2O4
and a molecular weight of 172.14 g/mol. Its IUPAC name is (2R)-2-amino-4,6-dioxopiperidine-2-carboxylic acid.
Molecular Properties
| Compound Name | (2R)-2-amino-4,6-dioxopiperidine-2-carboxylic acid |
| PubChem CID | 70469114 |
| Molecular Formula | C6H8N2O4 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | (2R)-2-amino-4,6-dioxopiperidine-2-carboxylic acid |
| SMILES | N[C@]1(C(=O)O)CC(=O)CC(=O)N1 |
| InChI | InChI=1S/C6H8N2O4/c7-6(5(11)12)2-3(9)1-4(10)8-6/h1-2,7H2,(H,8,10)(H,11,12)/t6-/m1/s1 |
| InChIKey | LSJKIBMZYAKJEW-ZCFIWIBFSA-N |
| XLogP | -1.79 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-amino-4,6-dioxopiperidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-4,6-dioxopiperidine-2-carboxylic acid?
The IUPAC name of (2R)-2-amino-4,6-dioxopiperidine-2-carboxylic acid (CID 70469114) is (2R)-2-amino-4,6-dioxopiperidine-2-carboxylic acid.
What is the SMILES notation for (2R)-2-amino-4,6-dioxopiperidine-2-carboxylic acid?
The canonical SMILES for (2R)-2-amino-4,6-dioxopiperidine-2-carboxylic acid is N[C@]1(C(=O)O)CC(=O)CC(=O)N1.
What is the InChIKey of (2R)-2-amino-4,6-dioxopiperidine-2-carboxylic acid?
The InChIKey is LSJKIBMZYAKJEW-ZCFIWIBFSA-N. The full InChI is InChI=1S/C6H8N2O4/c7-6(5(11)12)2-3(9)1-4(10)8-6/h1-2,7H2,(H,8,10)(H,11,12)/t6-/m1/s1.
What are the key properties of (2R)-2-amino-4,6-dioxopiperidine-2-carboxylic acid?
(2R)-2-amino-4,6-dioxopiperidine-2-carboxylic acid has a molecular weight of 172.14 g/mol, XLogP of -1.79, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-4,6-dioxopiperidine-2-carboxylic acid is sourced from PubChem (CID 70469114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).