About [3,5-diethyl-4-[(N'-methylcarbamimidoyl)carbamoylamino]phenyl] acetate
[3,5-diethyl-4-[(N'-methylcarbamimidoyl)carbamoylamino]phenyl] acetate (PubChem CID 70469504) has the molecular formula C15H22N4O3
and a molecular weight of 306.37 g/mol. Its IUPAC name is [3,5-diethyl-4-[(N'-methylcarbamimidoyl)carbamoylamino]phenyl] acetate.
Molecular Properties
| Compound Name | [3,5-diethyl-4-[(N'-methylcarbamimidoyl)carbamoylamino]phenyl] acetate |
| PubChem CID | 70469504 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | [3,5-diethyl-4-[(N'-methylcarbamimidoyl)carbamoylamino]phenyl] acetate |
| SMILES | CCc1cc(OC(C)=O)cc(CC)c1NC(=O)N/C(N)=N/C |
| InChI | InChI=1S/C15H22N4O3/c1-5-10-7-12(22-9(3)20)8-11(6-2)13(10)18-15(21)19-14(16)17-4/h7-8H,5-6H2,1-4H3,(H4,16,17,18,19,21) |
| InChIKey | HHAPWJZUOBJJBR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3,5-diethyl-4-[(N'-methylcarbamimidoyl)carbamoylamino]phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-diethyl-4-[(N'-methylcarbamimidoyl)carbamoylamino]phenyl] acetate?
The IUPAC name of [3,5-diethyl-4-[(N'-methylcarbamimidoyl)carbamoylamino]phenyl] acetate (CID 70469504) is [3,5-diethyl-4-[(N'-methylcarbamimidoyl)carbamoylamino]phenyl] acetate.
What is the SMILES notation for [3,5-diethyl-4-[(N'-methylcarbamimidoyl)carbamoylamino]phenyl] acetate?
The canonical SMILES for [3,5-diethyl-4-[(N'-methylcarbamimidoyl)carbamoylamino]phenyl] acetate is CCc1cc(OC(C)=O)cc(CC)c1NC(=O)N/C(N)=N/C.
What is the InChIKey of [3,5-diethyl-4-[(N'-methylcarbamimidoyl)carbamoylamino]phenyl] acetate?
The InChIKey is HHAPWJZUOBJJBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4O3/c1-5-10-7-12(22-9(3)20)8-11(6-2)13(10)18-15(21)19-14(16)17-4/h7-8H,5-6H2,1-4H3,(H4,16,17,18,19,21).
What are the key properties of [3,5-diethyl-4-[(N'-methylcarbamimidoyl)carbamoylamino]phenyl] acetate?
[3,5-diethyl-4-[(N'-methylcarbamimidoyl)carbamoylamino]phenyl] acetate has a molecular weight of 306.37 g/mol, XLogP of 1.80, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-diethyl-4-[(N'-methylcarbamimidoyl)carbamoylamino]phenyl] acetate is sourced from PubChem (CID 70469504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).