About trimethoxymethane;4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one
trimethoxymethane;4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one (PubChem CID 70469851) has the molecular formula C17H30O4
and a molecular weight of 298.42 g/mol. Its IUPAC name is trimethoxymethane;4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one.
Molecular Properties
| Compound Name | trimethoxymethane;4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one |
| PubChem CID | 70469851 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | trimethoxymethane;4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one |
| SMILES | CC(=O)C=CC1=C(C)CCCC1(C)C.COC(OC)OC |
| InChI | InChI=1S/C13H20O.C4H10O3/c1-10-6-5-9-13(3,4)12(10)8-7-11(2)14;1-5-4(6-2)7-3/h7-8H,5-6,9H2,1-4H3;4H,1-3H3 |
| InChIKey | MMIHDKPJJCJENX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze trimethoxymethane;4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethoxymethane;4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one?
The IUPAC name of trimethoxymethane;4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one (CID 70469851) is trimethoxymethane;4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one.
What is the SMILES notation for trimethoxymethane;4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one?
The canonical SMILES for trimethoxymethane;4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one is CC(=O)C=CC1=C(C)CCCC1(C)C.COC(OC)OC.
What is the InChIKey of trimethoxymethane;4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one?
The InChIKey is MMIHDKPJJCJENX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O.C4H10O3/c1-10-6-5-9-13(3,4)12(10)8-7-11(2)14;1-5-4(6-2)7-3/h7-8H,5-6,9H2,1-4H3;4H,1-3H3.
What are the key properties of trimethoxymethane;4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one?
trimethoxymethane;4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one has a molecular weight of 298.42 g/mol, XLogP of 3.87, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trimethoxymethane;4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one is sourced from PubChem (CID 70469851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).