C14H20N2O9S — CID 70469983
acetyloxymethyl (2S,5R,6S)-6-[(2-aminoacetyl)oxymethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70469983) has the molecular formula C14H20N2O9S and a molecular weight of 392.39 g/mol. Its IUPAC name is acetyloxymethyl (2S,5R,6S)-6-[(2-aminoacetyl)oxymethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | acetyloxymethyl (2S,5R,6S)-6-[(2-aminoacetyl)oxymethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70469983 |
| Molecular Formula | C14H20N2O9S |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | acetyloxymethyl (2S,5R,6S)-6-[(2-aminoacetyl)oxymethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC(=O)OCOC(=O)[C@@H]1N2C(=O)[C@H](COC(=O)CN)[C@H]2S(=O)(=O)C1(C)C |
| InChI | InChI=1S/C14H20N2O9S/c1-7(17)24-6-25-13(20)10-14(2,3)26(21,22)12-8(11(19)16(10)12)5-23-9(18)4-15/h8,10,12H,4-6,15H2,1-3H3/t8-,10-,12+/m0/s1 |
| InChIKey | FELZBDZICVIZRO-PTOFAABTSA-N |
| XLogP | -2.09 |
| TPSA | 159.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|