C15H16O7 — CID 70470330
4,7,7,9-tetramethoxy-6H-furo[3,2-g]chromen-5-one (PubChem CID 70470330) has the molecular formula C15H16O7 and a molecular weight of 308.29 g/mol. Its IUPAC name is 4,7,7,9-tetramethoxy-6H-furo[3,2-g]chromen-5-one.
| Compound Name | 4,7,7,9-tetramethoxy-6H-furo[3,2-g]chromen-5-one |
|---|---|
| PubChem CID | 70470330 |
| Molecular Formula | C15H16O7 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 4,7,7,9-tetramethoxy-6H-furo[3,2-g]chromen-5-one |
| SMILES | COc1c2c(c(OC)c3occc13)OC(OC)(OC)CC2=O |
| InChI | InChI=1S/C15H16O7/c1-17-11-8-5-6-21-12(8)14(18-2)13-10(11)9(16)7-15(19-3,20-4)22-13/h5-6H,7H2,1-4H3 |
| InChIKey | WJIXLMSCMHCNHW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 76.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|