About 1-(2-sulfamoyl-1,3-benzothiazol-5-yl)cyclohexane-1-carboxylic acid
1-(2-sulfamoyl-1,3-benzothiazol-5-yl)cyclohexane-1-carboxylic acid (PubChem CID 70470525) has the molecular formula C14H16N2O4S2
and a molecular weight of 340.43 g/mol. Its IUPAC name is 1-(2-sulfamoyl-1,3-benzothiazol-5-yl)cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-(2-sulfamoyl-1,3-benzothiazol-5-yl)cyclohexane-1-carboxylic acid |
| PubChem CID | 70470525 |
| Molecular Formula | C14H16N2O4S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 1-(2-sulfamoyl-1,3-benzothiazol-5-yl)cyclohexane-1-carboxylic acid |
| SMILES | NS(=O)(=O)c1nc2cc(C3(C(=O)O)CCCCC3)ccc2s1 |
| InChI | InChI=1S/C14H16N2O4S2/c15-22(19,20)13-16-10-8-9(4-5-11(10)21-13)14(12(17)18)6-2-1-3-7-14/h4-5,8H,1-3,6-7H2,(H,17,18)(H2,15,19,20) |
| InChIKey | DNEHFKJGOBQOEN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2-sulfamoyl-1,3-benzothiazol-5-yl)cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-sulfamoyl-1,3-benzothiazol-5-yl)cyclohexane-1-carboxylic acid?
The IUPAC name of 1-(2-sulfamoyl-1,3-benzothiazol-5-yl)cyclohexane-1-carboxylic acid (CID 70470525) is 1-(2-sulfamoyl-1,3-benzothiazol-5-yl)cyclohexane-1-carboxylic acid.
What is the SMILES notation for 1-(2-sulfamoyl-1,3-benzothiazol-5-yl)cyclohexane-1-carboxylic acid?
The canonical SMILES for 1-(2-sulfamoyl-1,3-benzothiazol-5-yl)cyclohexane-1-carboxylic acid is NS(=O)(=O)c1nc2cc(C3(C(=O)O)CCCCC3)ccc2s1.
What is the InChIKey of 1-(2-sulfamoyl-1,3-benzothiazol-5-yl)cyclohexane-1-carboxylic acid?
The InChIKey is DNEHFKJGOBQOEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O4S2/c15-22(19,20)13-16-10-8-9(4-5-11(10)21-13)14(12(17)18)6-2-1-3-7-14/h4-5,8H,1-3,6-7H2,(H,17,18)(H2,15,19,20).
What are the key properties of 1-(2-sulfamoyl-1,3-benzothiazol-5-yl)cyclohexane-1-carboxylic acid?
1-(2-sulfamoyl-1,3-benzothiazol-5-yl)cyclohexane-1-carboxylic acid has a molecular weight of 340.43 g/mol, XLogP of 2.23, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-sulfamoyl-1,3-benzothiazol-5-yl)cyclohexane-1-carboxylic acid is sourced from PubChem (CID 70470525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).