C28H36N4O9 — CID 70470602
2-[6-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]hexanoylamino]benzamide;oxalic acid (PubChem CID 70470602) has the molecular formula C28H36N4O9 and a molecular weight of 572.62 g/mol. Its IUPAC name is 2-[6-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]hexanoylamino]benzamide;oxalic acid.
| Compound Name | 2-[6-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]hexanoylamino]benzamide;oxalic acid |
|---|---|
| PubChem CID | 70470602 |
| Molecular Formula | C28H36N4O9 |
| Molecular Weight | 572.62 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | 2-[6-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]hexanoylamino]benzamide;oxalic acid |
| SMILES | COc1ccc(C(=O)N2CCN(CCCCCC(=O)Nc3ccccc3C(N)=O)CC2)cc1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C26H34N4O5.C2H2O4/c1-34-22-12-11-19(18-23(22)35-2)26(33)30-16-14-29(15-17-30)13-7-3-4-10-24(31)28-21-9-6-5-8-20(21)25(27)32;3-1(4)2(5)6/h5-6,8-9,11-12,18H,3-4,7,10,13-17H2,1-2H3,(H2,27,32)(H,28,31);(H,3,4)(H,5,6) |
| InChIKey | DDGITZCWFUSQJM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 188.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.62 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|