About 8-bromo-6-chloro-1,2,3,4-tetrahydroquinoline
8-bromo-6-chloro-1,2,3,4-tetrahydroquinoline (PubChem CID 70470751) has the molecular formula C9H9BrClN
and a molecular weight of 246.53 g/mol. Its IUPAC name is 8-bromo-6-chloro-1,2,3,4-tetrahydroquinoline.
Molecular Properties
| Compound Name | 8-bromo-6-chloro-1,2,3,4-tetrahydroquinoline |
| PubChem CID | 70470751 |
| Molecular Formula | C9H9BrClN |
| Molecular Weight | 246.53 g/mol |
| Exact Mass | 244.96 |
| IUPAC Name | 8-bromo-6-chloro-1,2,3,4-tetrahydroquinoline |
| SMILES | Clc1cc(Br)c2c(c1)CCCN2 |
| InChI | InChI=1S/C9H9BrClN/c10-8-5-7(11)4-6-2-1-3-12-9(6)8/h4-5,12H,1-3H2 |
| InChIKey | FIGCYUUCCAJSQG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-bromo-6-chloro-1,2,3,4-tetrahydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-6-chloro-1,2,3,4-tetrahydroquinoline?
The IUPAC name of 8-bromo-6-chloro-1,2,3,4-tetrahydroquinoline (CID 70470751) is 8-bromo-6-chloro-1,2,3,4-tetrahydroquinoline.
What is the SMILES notation for 8-bromo-6-chloro-1,2,3,4-tetrahydroquinoline?
The canonical SMILES for 8-bromo-6-chloro-1,2,3,4-tetrahydroquinoline is Clc1cc(Br)c2c(c1)CCCN2.
What is the InChIKey of 8-bromo-6-chloro-1,2,3,4-tetrahydroquinoline?
The InChIKey is FIGCYUUCCAJSQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrClN/c10-8-5-7(11)4-6-2-1-3-12-9(6)8/h4-5,12H,1-3H2.
What are the key properties of 8-bromo-6-chloro-1,2,3,4-tetrahydroquinoline?
8-bromo-6-chloro-1,2,3,4-tetrahydroquinoline has a molecular weight of 246.53 g/mol, XLogP of 3.46, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-6-chloro-1,2,3,4-tetrahydroquinoline is sourced from PubChem (CID 70470751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).