C12H14O3 — CID 70470886
2-(hydroxymethyl)-5-phenylpent-2-enoic acid (PubChem CID 70470886) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-(hydroxymethyl)-5-phenylpent-2-enoic acid.
| Compound Name | 2-(hydroxymethyl)-5-phenylpent-2-enoic acid |
|---|---|
| PubChem CID | 70470886 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 2-(hydroxymethyl)-5-phenylpent-2-enoic acid |
| SMILES | O=C(O)C(=CCCc1ccccc1)CO |
| InChI | InChI=1S/C12H14O3/c13-9-11(12(14)15)8-4-7-10-5-2-1-3-6-10/h1-3,5-6,8,13H,4,7,9H2,(H,14,15) |
| InChIKey | SOLLCWULFZDMHB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|