C21H24N2O3 — CID 70470896
(1Z,6Z)-2,6-diethoxy-1,7-dipyridin-4-ylhepta-1,6-dien-4-one (PubChem CID 70470896) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is (1Z,6Z)-2,6-diethoxy-1,7-dipyridin-4-ylhepta-1,6-dien-4-one.
| Compound Name | (1Z,6Z)-2,6-diethoxy-1,7-dipyridin-4-ylhepta-1,6-dien-4-one |
|---|---|
| PubChem CID | 70470896 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (1Z,6Z)-2,6-diethoxy-1,7-dipyridin-4-ylhepta-1,6-dien-4-one |
| SMILES | CCO/C(=C\c1ccncc1)CC(=O)C/C(=C/c1ccncc1)OCC |
| InChI | InChI=1S/C21H24N2O3/c1-3-25-20(13-17-5-9-22-10-6-17)15-19(24)16-21(26-4-2)14-18-7-11-23-12-8-18/h5-14H,3-4,15-16H2,1-2H3/b20-13-,21-14- |
| InChIKey | XZRICZFDMNIWPQ-NMGXZBPKSA-N |
| XLogP | 4.28 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|