C16H15F3N2O4 — CID 70471013
ethyl 2-(2,1,3-benzoxadiazol-4-ylmethylidene)-5-fluoro-4,4-bis(fluoromethyl)-3-oxopentanoate (PubChem CID 70471013) has the molecular formula C16H15F3N2O4 and a molecular weight of 356.30 g/mol. Its IUPAC name is ethyl 2-(2,1,3-benzoxadiazol-4-ylmethylidene)-5-fluoro-4,4-bis(fluoromethyl)-3-oxopentanoate.
| Compound Name | ethyl 2-(2,1,3-benzoxadiazol-4-ylmethylidene)-5-fluoro-4,4-bis(fluoromethyl)-3-oxopentanoate |
|---|---|
| PubChem CID | 70471013 |
| Molecular Formula | C16H15F3N2O4 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | ethyl 2-(2,1,3-benzoxadiazol-4-ylmethylidene)-5-fluoro-4,4-bis(fluoromethyl)-3-oxopentanoate |
| SMILES | CCOC(=O)C(=Cc1cccc2nonc12)C(=O)C(CF)(CF)CF |
| InChI | InChI=1S/C16H15F3N2O4/c1-2-24-15(23)11(14(22)16(7-17,8-18)9-19)6-10-4-3-5-12-13(10)21-25-20-12/h3-6H,2,7-9H2,1H3 |
| InChIKey | NXVUBVMLKZLHQA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|