About 2,3-diethyl-5-(propoxymethyl)-1,4-dithiine
2,3-diethyl-5-(propoxymethyl)-1,4-dithiine (PubChem CID 70471113) has the molecular formula C12H20OS2
and a molecular weight of 244.42 g/mol. Its IUPAC name is 2,3-diethyl-5-(propoxymethyl)-1,4-dithiine.
Molecular Properties
| Compound Name | 2,3-diethyl-5-(propoxymethyl)-1,4-dithiine |
| PubChem CID | 70471113 |
| Molecular Formula | C12H20OS2 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2,3-diethyl-5-(propoxymethyl)-1,4-dithiine |
| SMILES | CCCOCC1=CSC(CC)=C(CC)S1 |
| InChI | InChI=1S/C12H20OS2/c1-4-7-13-8-10-9-14-11(5-2)12(6-3)15-10/h9H,4-8H2,1-3H3 |
| InChIKey | RWBWCAFORFKMJC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,3-diethyl-5-(propoxymethyl)-1,4-dithiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diethyl-5-(propoxymethyl)-1,4-dithiine?
The IUPAC name of 2,3-diethyl-5-(propoxymethyl)-1,4-dithiine (CID 70471113) is 2,3-diethyl-5-(propoxymethyl)-1,4-dithiine.
What is the SMILES notation for 2,3-diethyl-5-(propoxymethyl)-1,4-dithiine?
The canonical SMILES for 2,3-diethyl-5-(propoxymethyl)-1,4-dithiine is CCCOCC1=CSC(CC)=C(CC)S1.
What is the InChIKey of 2,3-diethyl-5-(propoxymethyl)-1,4-dithiine?
The InChIKey is RWBWCAFORFKMJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20OS2/c1-4-7-13-8-10-9-14-11(5-2)12(6-3)15-10/h9H,4-8H2,1-3H3.
What are the key properties of 2,3-diethyl-5-(propoxymethyl)-1,4-dithiine?
2,3-diethyl-5-(propoxymethyl)-1,4-dithiine has a molecular weight of 244.42 g/mol, XLogP of 4.77, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diethyl-5-(propoxymethyl)-1,4-dithiine is sourced from PubChem (CID 70471113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).