About 1-azidoazetidin-2-one
1-azidoazetidin-2-one (PubChem CID 70471446) has the molecular formula C3H4N4O
and a molecular weight of 112.09 g/mol. Its IUPAC name is 1-azidoazetidin-2-one.
Molecular Properties
| Compound Name | 1-azidoazetidin-2-one |
| PubChem CID | 70471446 |
| Molecular Formula | C3H4N4O |
| Molecular Weight | 112.09 g/mol |
| Exact Mass | 112.04 |
| IUPAC Name | 1-azidoazetidin-2-one |
| SMILES | [N-]=[N+]=NN1CCC1=O |
| InChI | InChI=1S/C3H4N4O/c4-5-6-7-2-1-3(7)8/h1-2H2 |
| InChIKey | UIDAPSJCRXJIIA-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 69.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.09 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-azidoazetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azidoazetidin-2-one?
The IUPAC name of 1-azidoazetidin-2-one (CID 70471446) is 1-azidoazetidin-2-one.
What is the SMILES notation for 1-azidoazetidin-2-one?
The canonical SMILES for 1-azidoazetidin-2-one is [N-]=[N+]=NN1CCC1=O.
What is the InChIKey of 1-azidoazetidin-2-one?
The InChIKey is UIDAPSJCRXJIIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N4O/c4-5-6-7-2-1-3(7)8/h1-2H2.
What are the key properties of 1-azidoazetidin-2-one?
1-azidoazetidin-2-one has a molecular weight of 112.09 g/mol, XLogP of 0.44, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azidoazetidin-2-one is sourced from PubChem (CID 70471446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).