About 6,7-dichloro-3-[(dimethylamino)methylsulfanyl]-2,3-dihydrochromen-4-one;hydrochloride
6,7-dichloro-3-[(dimethylamino)methylsulfanyl]-2,3-dihydrochromen-4-one;hydrochloride (PubChem CID 70471726) has the molecular formula C12H14Cl3NO2S
and a molecular weight of 342.68 g/mol. Its IUPAC name is 6,7-dichloro-3-[(dimethylamino)methylsulfanyl]-2,3-dihydrochromen-4-one;hydrochloride.
Molecular Properties
| Compound Name | 6,7-dichloro-3-[(dimethylamino)methylsulfanyl]-2,3-dihydrochromen-4-one;hydrochloride |
| PubChem CID | 70471726 |
| Molecular Formula | C12H14Cl3NO2S |
| Molecular Weight | 342.68 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | 6,7-dichloro-3-[(dimethylamino)methylsulfanyl]-2,3-dihydrochromen-4-one;hydrochloride |
| SMILES | CN(C)CSC1COc2cc(Cl)c(Cl)cc2C1=O.Cl |
| InChI | InChI=1S/C12H13Cl2NO2S.ClH/c1-15(2)6-18-11-5-17-10-4-9(14)8(13)3-7(10)12(11)16;/h3-4,11H,5-6H2,1-2H3;1H |
| InChIKey | MKDQMWKOAVUGIL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.68 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dichloro-3-[(dimethylamino)methylsulfanyl]-2,3-dihydrochromen-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dichloro-3-[(dimethylamino)methylsulfanyl]-2,3-dihydrochromen-4-one;hydrochloride?
The IUPAC name of 6,7-dichloro-3-[(dimethylamino)methylsulfanyl]-2,3-dihydrochromen-4-one;hydrochloride (CID 70471726) is 6,7-dichloro-3-[(dimethylamino)methylsulfanyl]-2,3-dihydrochromen-4-one;hydrochloride.
What is the SMILES notation for 6,7-dichloro-3-[(dimethylamino)methylsulfanyl]-2,3-dihydrochromen-4-one;hydrochloride?
The canonical SMILES for 6,7-dichloro-3-[(dimethylamino)methylsulfanyl]-2,3-dihydrochromen-4-one;hydrochloride is CN(C)CSC1COc2cc(Cl)c(Cl)cc2C1=O.Cl.
What is the InChIKey of 6,7-dichloro-3-[(dimethylamino)methylsulfanyl]-2,3-dihydrochromen-4-one;hydrochloride?
The InChIKey is MKDQMWKOAVUGIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13Cl2NO2S.ClH/c1-15(2)6-18-11-5-17-10-4-9(14)8(13)3-7(10)12(11)16;/h3-4,11H,5-6H2,1-2H3;1H.
What are the key properties of 6,7-dichloro-3-[(dimethylamino)methylsulfanyl]-2,3-dihydrochromen-4-one;hydrochloride?
6,7-dichloro-3-[(dimethylamino)methylsulfanyl]-2,3-dihydrochromen-4-one;hydrochloride has a molecular weight of 342.68 g/mol, XLogP of 3.61, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dichloro-3-[(dimethylamino)methylsulfanyl]-2,3-dihydrochromen-4-one;hydrochloride is sourced from PubChem (CID 70471726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).