C27H46N2O — CID 70471801
5,9,13,17-tetramethyl-1-(2-methylpiperazin-1-yl)octadeca-4,8,12,16-tetraen-1-one (PubChem CID 70471801) has the molecular formula C27H46N2O and a molecular weight of 414.68 g/mol. Its IUPAC name is 5,9,13,17-tetramethyl-1-(2-methylpiperazin-1-yl)octadeca-4,8,12,16-tetraen-1-one.
| Compound Name | 5,9,13,17-tetramethyl-1-(2-methylpiperazin-1-yl)octadeca-4,8,12,16-tetraen-1-one |
|---|---|
| PubChem CID | 70471801 |
| Molecular Formula | C27H46N2O |
| Molecular Weight | 414.68 g/mol |
| Exact Mass | 414.36 |
| IUPAC Name | 5,9,13,17-tetramethyl-1-(2-methylpiperazin-1-yl)octadeca-4,8,12,16-tetraen-1-one |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(=O)N1CCNCC1C |
| InChI | InChI=1S/C27H46N2O/c1-22(2)11-7-12-23(3)13-8-14-24(4)15-9-16-25(5)17-10-18-27(30)29-20-19-28-21-26(29)6/h11,13,15,17,26,28H,7-10,12,14,16,18-21H2,1-6H3 |
| InChIKey | RWDGXHIVAQGNRI-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.68 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|