C30H50N2O — CID 70471832
1-[1-but-2-enyl-4-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperazin-2-yl]ethanone (PubChem CID 70471832) has the molecular formula C30H50N2O and a molecular weight of 454.74 g/mol. Its IUPAC name is 1-[1-but-2-enyl-4-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperazin-2-yl]ethanone.
| Compound Name | 1-[1-but-2-enyl-4-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperazin-2-yl]ethanone |
|---|---|
| PubChem CID | 70471832 |
| Molecular Formula | C30H50N2O |
| Molecular Weight | 454.74 g/mol |
| Exact Mass | 454.39 |
| IUPAC Name | 1-[1-but-2-enyl-4-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperazin-2-yl]ethanone |
| SMILES | CC=CCN1CCN(C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)CC1C(C)=O |
| InChI | InChI=1S/C30H50N2O/c1-8-9-20-32-23-22-31(24-30(32)29(7)33)21-19-28(6)18-12-17-27(5)16-11-15-26(4)14-10-13-25(2)3/h8-9,13,15,17,19,30H,10-12,14,16,18,20-24H2,1-7H3/b9-8?,26-15+,27-17+,28-19+ |
| InChIKey | FYPPTFCCMJJBDQ-AFQMRBFCSA-N |
| XLogP | 7.28 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.74 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|