About 2-[6-fluoro-3-(1-methylpiperidin-4-yl)-2H-1,2-benzoxazol-3-yl]acetic acid
2-[6-fluoro-3-(1-methylpiperidin-4-yl)-2H-1,2-benzoxazol-3-yl]acetic acid (PubChem CID 70471966) has the molecular formula C15H19FN2O3
and a molecular weight of 294.33 g/mol. Its IUPAC name is 2-[6-fluoro-3-(1-methylpiperidin-4-yl)-2H-1,2-benzoxazol-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[6-fluoro-3-(1-methylpiperidin-4-yl)-2H-1,2-benzoxazol-3-yl]acetic acid |
| PubChem CID | 70471966 |
| Molecular Formula | C15H19FN2O3 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 2-[6-fluoro-3-(1-methylpiperidin-4-yl)-2H-1,2-benzoxazol-3-yl]acetic acid |
| SMILES | CN1CCC(C2(CC(=O)O)NOc3cc(F)ccc32)CC1 |
| InChI | InChI=1S/C15H19FN2O3/c1-18-6-4-10(5-7-18)15(9-14(19)20)12-3-2-11(16)8-13(12)21-17-15/h2-3,8,10,17H,4-7,9H2,1H3,(H,19,20) |
| InChIKey | JBBBUHXBSKQJFE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[6-fluoro-3-(1-methylpiperidin-4-yl)-2H-1,2-benzoxazol-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-fluoro-3-(1-methylpiperidin-4-yl)-2H-1,2-benzoxazol-3-yl]acetic acid?
The IUPAC name of 2-[6-fluoro-3-(1-methylpiperidin-4-yl)-2H-1,2-benzoxazol-3-yl]acetic acid (CID 70471966) is 2-[6-fluoro-3-(1-methylpiperidin-4-yl)-2H-1,2-benzoxazol-3-yl]acetic acid.
What is the SMILES notation for 2-[6-fluoro-3-(1-methylpiperidin-4-yl)-2H-1,2-benzoxazol-3-yl]acetic acid?
The canonical SMILES for 2-[6-fluoro-3-(1-methylpiperidin-4-yl)-2H-1,2-benzoxazol-3-yl]acetic acid is CN1CCC(C2(CC(=O)O)NOc3cc(F)ccc32)CC1.
What is the InChIKey of 2-[6-fluoro-3-(1-methylpiperidin-4-yl)-2H-1,2-benzoxazol-3-yl]acetic acid?
The InChIKey is JBBBUHXBSKQJFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19FN2O3/c1-18-6-4-10(5-7-18)15(9-14(19)20)12-3-2-11(16)8-13(12)21-17-15/h2-3,8,10,17H,4-7,9H2,1H3,(H,19,20).
What are the key properties of 2-[6-fluoro-3-(1-methylpiperidin-4-yl)-2H-1,2-benzoxazol-3-yl]acetic acid?
2-[6-fluoro-3-(1-methylpiperidin-4-yl)-2H-1,2-benzoxazol-3-yl]acetic acid has a molecular weight of 294.33 g/mol, XLogP of 1.73, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-fluoro-3-(1-methylpiperidin-4-yl)-2H-1,2-benzoxazol-3-yl]acetic acid is sourced from PubChem (CID 70471966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).