C8H14N4S2 — CID 70472300
4,6-bis(ethylsulfanyl)-N-methyl-1,3,5-triazin-2-amine (PubChem CID 70472300) has the molecular formula C8H14N4S2 and a molecular weight of 230.36 g/mol. Its IUPAC name is 4,6-bis(ethylsulfanyl)-N-methyl-1,3,5-triazin-2-amine.
| Compound Name | 4,6-bis(ethylsulfanyl)-N-methyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 70472300 |
| Molecular Formula | C8H14N4S2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 4,6-bis(ethylsulfanyl)-N-methyl-1,3,5-triazin-2-amine |
| SMILES | CCSc1nc(NC)nc(SCC)n1 |
| InChI | InChI=1S/C8H14N4S2/c1-4-13-7-10-6(9-3)11-8(12-7)14-5-2/h4-5H2,1-3H3,(H,9,10,11,12) |
| InChIKey | FRISTGIHAIZYBG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |