About 5-methyl-4-nitro-N-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carboxamide
5-methyl-4-nitro-N-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carboxamide (PubChem CID 70472411) has the molecular formula C7H7F3N4O3
and a molecular weight of 252.15 g/mol. Its IUPAC name is 5-methyl-4-nitro-N-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-methyl-4-nitro-N-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carboxamide |
| PubChem CID | 70472411 |
| Molecular Formula | C7H7F3N4O3 |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 5-methyl-4-nitro-N-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carboxamide |
| SMILES | Cc1[nH]nc(C(=O)NCC(F)(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H7F3N4O3/c1-3-5(14(16)17)4(13-12-3)6(15)11-2-7(8,9)10/h2H2,1H3,(H,11,15)(H,12,13) |
| InChIKey | JNTIVOVJZOVQBQ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-4-nitro-N-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4-nitro-N-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carboxamide?
The IUPAC name of 5-methyl-4-nitro-N-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carboxamide (CID 70472411) is 5-methyl-4-nitro-N-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carboxamide.
What is the SMILES notation for 5-methyl-4-nitro-N-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carboxamide?
The canonical SMILES for 5-methyl-4-nitro-N-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carboxamide is Cc1[nH]nc(C(=O)NCC(F)(F)F)c1[N+](=O)[O-].
What is the InChIKey of 5-methyl-4-nitro-N-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carboxamide?
The InChIKey is JNTIVOVJZOVQBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F3N4O3/c1-3-5(14(16)17)4(13-12-3)6(15)11-2-7(8,9)10/h2H2,1H3,(H,11,15)(H,12,13).
What are the key properties of 5-methyl-4-nitro-N-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carboxamide?
5-methyl-4-nitro-N-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carboxamide has a molecular weight of 252.15 g/mol, XLogP of 0.92, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4-nitro-N-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carboxamide is sourced from PubChem (CID 70472411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).