C17H14N4O2S2 — CID 70473122
2-[[4,6-bis(phenylsulfanyl)-1,3,5-triazin-2-yl]amino]acetic acid (PubChem CID 70473122) has the molecular formula C17H14N4O2S2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 2-[[4,6-bis(phenylsulfanyl)-1,3,5-triazin-2-yl]amino]acetic acid.
| Compound Name | 2-[[4,6-bis(phenylsulfanyl)-1,3,5-triazin-2-yl]amino]acetic acid |
|---|---|
| PubChem CID | 70473122 |
| Molecular Formula | C17H14N4O2S2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 2-[[4,6-bis(phenylsulfanyl)-1,3,5-triazin-2-yl]amino]acetic acid |
| SMILES | O=C(O)CNc1nc(Sc2ccccc2)nc(Sc2ccccc2)n1 |
| InChI | InChI=1S/C17H14N4O2S2/c22-14(23)11-18-15-19-16(24-12-7-3-1-4-8-12)21-17(20-15)25-13-9-5-2-6-10-13/h1-10H,11H2,(H,22,23)(H,18,19,20,21) |
| InChIKey | FJIDXKOZZPQDSH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |