C21H19N3OS — CID 70473266
2-[(5-methyl-4-phenylmethoxy-2-pyridinyl)methylsulfanyl]-1H-benzimidazole (PubChem CID 70473266) has the molecular formula C21H19N3OS and a molecular weight of 361.47 g/mol. Its IUPAC name is 2-[(5-methyl-4-phenylmethoxy-2-pyridinyl)methylsulfanyl]-1H-benzimidazole.
| Compound Name | 2-[(5-methyl-4-phenylmethoxy-2-pyridinyl)methylsulfanyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 70473266 |
| Molecular Formula | C21H19N3OS |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 2-[(5-methyl-4-phenylmethoxy-2-pyridinyl)methylsulfanyl]-1H-benzimidazole |
| SMILES | Cc1cnc(CSc2nc3ccccc3[nH]2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C21H19N3OS/c1-15-12-22-17(11-20(15)25-13-16-7-3-2-4-8-16)14-26-21-23-18-9-5-6-10-19(18)24-21/h2-12H,13-14H2,1H3,(H,23,24) |
| InChIKey | XFGPODVQPBQFFE-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |