About [2,6-bis(4-chlorophenyl)-4-pyridinyl] hydrogen carbonate
[2,6-bis(4-chlorophenyl)-4-pyridinyl] hydrogen carbonate (PubChem CID 70473325) has the molecular formula C18H11Cl2NO3
and a molecular weight of 360.20 g/mol. Its IUPAC name is [2,6-bis(4-chlorophenyl)-4-pyridinyl] hydrogen carbonate.
Molecular Properties
| Compound Name | [2,6-bis(4-chlorophenyl)-4-pyridinyl] hydrogen carbonate |
| PubChem CID | 70473325 |
| Molecular Formula | C18H11Cl2NO3 |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | [2,6-bis(4-chlorophenyl)-4-pyridinyl] hydrogen carbonate |
| SMILES | O=C(O)Oc1cc(-c2ccc(Cl)cc2)nc(-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C18H11Cl2NO3/c19-13-5-1-11(2-6-13)16-9-15(24-18(22)23)10-17(21-16)12-3-7-14(20)8-4-12/h1-10H,(H,22,23) |
| InChIKey | CPFPTRNXJJVSLJ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2,6-bis(4-chlorophenyl)-4-pyridinyl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-bis(4-chlorophenyl)-4-pyridinyl] hydrogen carbonate?
The IUPAC name of [2,6-bis(4-chlorophenyl)-4-pyridinyl] hydrogen carbonate (CID 70473325) is [2,6-bis(4-chlorophenyl)-4-pyridinyl] hydrogen carbonate.
What is the SMILES notation for [2,6-bis(4-chlorophenyl)-4-pyridinyl] hydrogen carbonate?
The canonical SMILES for [2,6-bis(4-chlorophenyl)-4-pyridinyl] hydrogen carbonate is O=C(O)Oc1cc(-c2ccc(Cl)cc2)nc(-c2ccc(Cl)cc2)c1.
What is the InChIKey of [2,6-bis(4-chlorophenyl)-4-pyridinyl] hydrogen carbonate?
The InChIKey is CPFPTRNXJJVSLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11Cl2NO3/c19-13-5-1-11(2-6-13)16-9-15(24-18(22)23)10-17(21-16)12-3-7-14(20)8-4-12/h1-10H,(H,22,23).
What are the key properties of [2,6-bis(4-chlorophenyl)-4-pyridinyl] hydrogen carbonate?
[2,6-bis(4-chlorophenyl)-4-pyridinyl] hydrogen carbonate has a molecular weight of 360.20 g/mol, XLogP of 5.78, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-bis(4-chlorophenyl)-4-pyridinyl] hydrogen carbonate is sourced from PubChem (CID 70473325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).