About furo[3,2-b]pyridine;thieno[3,4-c]pyridine
furo[3,2-b]pyridine;thieno[3,4-c]pyridine (PubChem CID 70473386) has the molecular formula C14H10N2OS
and a molecular weight of 254.31 g/mol. Its IUPAC name is furo[3,2-b]pyridine;thieno[3,4-c]pyridine.
Molecular Properties
| Compound Name | furo[3,2-b]pyridine;thieno[3,4-c]pyridine |
| PubChem CID | 70473386 |
| Molecular Formula | C14H10N2OS |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | furo[3,2-b]pyridine;thieno[3,4-c]pyridine |
| SMILES | c1cc2cscc2cn1.c1cnc2ccoc2c1 |
| InChI | InChI=1S/C7H5NO.C7H5NS/c1-2-7-6(8-4-1)3-5-9-7;1-2-8-3-7-5-9-4-6(1)7/h2*1-5H |
| InChIKey | CKPKOQKVZOBYCK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze furo[3,2-b]pyridine;thieno[3,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furo[3,2-b]pyridine;thieno[3,4-c]pyridine?
The IUPAC name of furo[3,2-b]pyridine;thieno[3,4-c]pyridine (CID 70473386) is furo[3,2-b]pyridine;thieno[3,4-c]pyridine.
What is the SMILES notation for furo[3,2-b]pyridine;thieno[3,4-c]pyridine?
The canonical SMILES for furo[3,2-b]pyridine;thieno[3,4-c]pyridine is c1cc2cscc2cn1.c1cnc2ccoc2c1.
What is the InChIKey of furo[3,2-b]pyridine;thieno[3,4-c]pyridine?
The InChIKey is CKPKOQKVZOBYCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO.C7H5NS/c1-2-7-6(8-4-1)3-5-9-7;1-2-8-3-7-5-9-4-6(1)7/h2*1-5H.
What are the key properties of furo[3,2-b]pyridine;thieno[3,4-c]pyridine?
furo[3,2-b]pyridine;thieno[3,4-c]pyridine has a molecular weight of 254.31 g/mol, XLogP of 4.12, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for furo[3,2-b]pyridine;thieno[3,4-c]pyridine is sourced from PubChem (CID 70473386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).