About 3-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-1-(iodomethyl)imidazolidin-2-one
3-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-1-(iodomethyl)imidazolidin-2-one (PubChem CID 70473772) has the molecular formula C10H15IN4O2S
and a molecular weight of 382.23 g/mol. Its IUPAC name is 3-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-1-(iodomethyl)imidazolidin-2-one.
Molecular Properties
| Compound Name | 3-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-1-(iodomethyl)imidazolidin-2-one |
| PubChem CID | 70473772 |
| Molecular Formula | C10H15IN4O2S |
| Molecular Weight | 382.23 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | 3-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-1-(iodomethyl)imidazolidin-2-one |
| SMILES | CC(C)(C)c1nnc(N2C(=O)N(CI)CC2O)s1 |
| InChI | InChI=1S/C10H15IN4O2S/c1-10(2,3)7-12-13-8(18-7)15-6(16)4-14(5-11)9(15)17/h6,16H,4-5H2,1-3H3 |
| InChIKey | XFZNIFPAVKFYRC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.23 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-1-(iodomethyl)imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-1-(iodomethyl)imidazolidin-2-one?
The IUPAC name of 3-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-1-(iodomethyl)imidazolidin-2-one (CID 70473772) is 3-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-1-(iodomethyl)imidazolidin-2-one.
What is the SMILES notation for 3-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-1-(iodomethyl)imidazolidin-2-one?
The canonical SMILES for 3-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-1-(iodomethyl)imidazolidin-2-one is CC(C)(C)c1nnc(N2C(=O)N(CI)CC2O)s1.
What is the InChIKey of 3-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-1-(iodomethyl)imidazolidin-2-one?
The InChIKey is XFZNIFPAVKFYRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15IN4O2S/c1-10(2,3)7-12-13-8(18-7)15-6(16)4-14(5-11)9(15)17/h6,16H,4-5H2,1-3H3.
What are the key properties of 3-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-1-(iodomethyl)imidazolidin-2-one?
3-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-1-(iodomethyl)imidazolidin-2-one has a molecular weight of 382.23 g/mol, XLogP of 1.79, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-1-(iodomethyl)imidazolidin-2-one is sourced from PubChem (CID 70473772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).