C18H26N6O2 — CID 70474063
5-N,1-dimethyl-5-N-[5-(piperidin-1-ylmethyl)-2,3-dihydro-1,4-benzodioxin-3-yl]-1,2,4-triazole-3,5-diamine (PubChem CID 70474063) has the molecular formula C18H26N6O2 and a molecular weight of 358.45 g/mol. Its IUPAC name is 5-N,1-dimethyl-5-N-[5-(piperidin-1-ylmethyl)-2,3-dihydro-1,4-benzodioxin-3-yl]-1,2,4-triazole-3,5-diamine.
| Compound Name | 5-N,1-dimethyl-5-N-[5-(piperidin-1-ylmethyl)-2,3-dihydro-1,4-benzodioxin-3-yl]-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 70474063 |
| Molecular Formula | C18H26N6O2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 5-N,1-dimethyl-5-N-[5-(piperidin-1-ylmethyl)-2,3-dihydro-1,4-benzodioxin-3-yl]-1,2,4-triazole-3,5-diamine |
| SMILES | CN(c1nc(N)nn1C)C1COc2cccc(CN3CCCCC3)c2O1 |
| InChI | InChI=1S/C18H26N6O2/c1-22(18-20-17(19)21-23(18)2)15-12-25-14-8-6-7-13(16(14)26-15)11-24-9-4-3-5-10-24/h6-8,15H,3-5,9-12H2,1-2H3,(H2,19,21) |
| InChIKey | FBQYOKHLUIBYKO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |