C18H26N6O2 — CID 70474067
1-methyl-5-N-[[5-(piperidin-1-ylmethyl)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-1,2,4-triazole-3,5-diamine (PubChem CID 70474067) has the molecular formula C18H26N6O2 and a molecular weight of 358.45 g/mol. Its IUPAC name is 1-methyl-5-N-[[5-(piperidin-1-ylmethyl)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-methyl-5-N-[[5-(piperidin-1-ylmethyl)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 70474067 |
| Molecular Formula | C18H26N6O2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 1-methyl-5-N-[[5-(piperidin-1-ylmethyl)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-1,2,4-triazole-3,5-diamine |
| SMILES | Cn1nc(N)nc1NCC1COc2cccc(CN3CCCCC3)c2O1 |
| InChI | InChI=1S/C18H26N6O2/c1-23-18(21-17(19)22-23)20-10-14-12-25-15-7-5-6-13(16(15)26-14)11-24-8-3-2-4-9-24/h5-7,14H,2-4,8-12H2,1H3,(H3,19,20,21,22) |
| InChIKey | RWILEJLJPBEBRS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |