About [4-[2-(cyclopropylamino)acetyl]-7-hydroxy-1H-indol-2-yl] ethyl carbonate;hydrochloride
[4-[2-(cyclopropylamino)acetyl]-7-hydroxy-1H-indol-2-yl] ethyl carbonate;hydrochloride (PubChem CID 70474237) has the molecular formula C16H19ClN2O5
and a molecular weight of 354.79 g/mol. Its IUPAC name is [4-[2-(cyclopropylamino)acetyl]-7-hydroxy-1H-indol-2-yl] ethyl carbonate;hydrochloride.
Molecular Properties
| Compound Name | [4-[2-(cyclopropylamino)acetyl]-7-hydroxy-1H-indol-2-yl] ethyl carbonate;hydrochloride |
| PubChem CID | 70474237 |
| Molecular Formula | C16H19ClN2O5 |
| Molecular Weight | 354.79 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | [4-[2-(cyclopropylamino)acetyl]-7-hydroxy-1H-indol-2-yl] ethyl carbonate;hydrochloride |
| SMILES | CCOC(=O)Oc1cc2c(C(=O)CNC3CC3)ccc(O)c2[nH]1.Cl |
| InChI | InChI=1S/C16H18N2O5.ClH/c1-2-22-16(21)23-14-7-11-10(5-6-12(19)15(11)18-14)13(20)8-17-9-3-4-9;/h5-7,9,17-19H,2-4,8H2,1H3;1H |
| InChIKey | WDXQHXULIGOXHV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.79 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-[2-(cyclopropylamino)acetyl]-7-hydroxy-1H-indol-2-yl] ethyl carbonate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(cyclopropylamino)acetyl]-7-hydroxy-1H-indol-2-yl] ethyl carbonate;hydrochloride?
The IUPAC name of [4-[2-(cyclopropylamino)acetyl]-7-hydroxy-1H-indol-2-yl] ethyl carbonate;hydrochloride (CID 70474237) is [4-[2-(cyclopropylamino)acetyl]-7-hydroxy-1H-indol-2-yl] ethyl carbonate;hydrochloride.
What is the SMILES notation for [4-[2-(cyclopropylamino)acetyl]-7-hydroxy-1H-indol-2-yl] ethyl carbonate;hydrochloride?
The canonical SMILES for [4-[2-(cyclopropylamino)acetyl]-7-hydroxy-1H-indol-2-yl] ethyl carbonate;hydrochloride is CCOC(=O)Oc1cc2c(C(=O)CNC3CC3)ccc(O)c2[nH]1.Cl.
What is the InChIKey of [4-[2-(cyclopropylamino)acetyl]-7-hydroxy-1H-indol-2-yl] ethyl carbonate;hydrochloride?
The InChIKey is WDXQHXULIGOXHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O5.ClH/c1-2-22-16(21)23-14-7-11-10(5-6-12(19)15(11)18-14)13(20)8-17-9-3-4-9;/h5-7,9,17-19H,2-4,8H2,1H3;1H.
What are the key properties of [4-[2-(cyclopropylamino)acetyl]-7-hydroxy-1H-indol-2-yl] ethyl carbonate;hydrochloride?
[4-[2-(cyclopropylamino)acetyl]-7-hydroxy-1H-indol-2-yl] ethyl carbonate;hydrochloride has a molecular weight of 354.79 g/mol, XLogP of 2.77, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(cyclopropylamino)acetyl]-7-hydroxy-1H-indol-2-yl] ethyl carbonate;hydrochloride is sourced from PubChem (CID 70474237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).