C13H13N3 — CID 70474514
2,11,12-triazatetracyclo[7.6.1.05,16.010,14]hexadeca-7,9(16),10,12,14-pentaene (PubChem CID 70474514) has the molecular formula C13H13N3 and a molecular weight of 211.27 g/mol. Its IUPAC name is 2,11,12-triazatetracyclo[7.6.1.05,16.010,14]hexadeca-7,9(16),10,12,14-pentaene.
| Compound Name | 2,11,12-triazatetracyclo[7.6.1.05,16.010,14]hexadeca-7,9(16),10,12,14-pentaene |
|---|---|
| PubChem CID | 70474514 |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 2,11,12-triazatetracyclo[7.6.1.05,16.010,14]hexadeca-7,9(16),10,12,14-pentaene |
| SMILES | C1=CC2=C3C(C1)CCNC3C=C1C=NN=C12 |
| InChI | InChI=1S/C13H13N3/c1-2-8-4-5-14-11-6-9-7-15-16-13(9)10(3-1)12(8)11/h1,3,6-8,11,14H,2,4-5H2 |
| InChIKey | HBRSDJPBWPDXOW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |