C16H22BrNOS — CID 70474791
4-[[5-bromo-2-(2-methylthiolan-2-yl)phenyl]methyl]morpholine (PubChem CID 70474791) has the molecular formula C16H22BrNOS and a molecular weight of 356.33 g/mol. Its IUPAC name is 4-[[5-bromo-2-(2-methylthiolan-2-yl)phenyl]methyl]morpholine.
| Compound Name | 4-[[5-bromo-2-(2-methylthiolan-2-yl)phenyl]methyl]morpholine |
|---|---|
| PubChem CID | 70474791 |
| Molecular Formula | C16H22BrNOS |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 4-[[5-bromo-2-(2-methylthiolan-2-yl)phenyl]methyl]morpholine |
| SMILES | CC1(c2ccc(Br)cc2CN2CCOCC2)CCCS1 |
| InChI | InChI=1S/C16H22BrNOS/c1-16(5-2-10-20-16)15-4-3-14(17)11-13(15)12-18-6-8-19-9-7-18/h3-4,11H,2,5-10,12H2,1H3 |
| InChIKey | VCUGYEXNYGMMMR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |