About [5-ethoxycarbonyloxy-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-3-pyridinyl] 2-hydroxyethyl carbonate
[5-ethoxycarbonyloxy-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-3-pyridinyl] 2-hydroxyethyl carbonate (PubChem CID 70474794) has the molecular formula C20H20F3NO7
and a molecular weight of 443.37 g/mol. Its IUPAC name is [5-ethoxycarbonyloxy-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-3-pyridinyl] 2-hydroxyethyl carbonate.
Molecular Properties
| Compound Name | [5-ethoxycarbonyloxy-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-3-pyridinyl] 2-hydroxyethyl carbonate |
| PubChem CID | 70474794 |
| Molecular Formula | C20H20F3NO7 |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | [5-ethoxycarbonyloxy-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-3-pyridinyl] 2-hydroxyethyl carbonate |
| SMILES | CCOC(=O)Oc1c(C)nc(C)c(OC(=O)OCCO)c1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H20F3NO7/c1-4-28-18(26)30-16-11(2)24-12(3)17(31-19(27)29-10-9-25)15(16)13-7-5-6-8-14(13)20(21,22)23/h5-8,25H,4,9-10H2,1-3H3 |
| InChIKey | AHTIEQSDRRKZOM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 104.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [5-ethoxycarbonyloxy-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-3-pyridinyl] 2-hydroxyethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-ethoxycarbonyloxy-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-3-pyridinyl] 2-hydroxyethyl carbonate?
The IUPAC name of [5-ethoxycarbonyloxy-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-3-pyridinyl] 2-hydroxyethyl carbonate (CID 70474794) is [5-ethoxycarbonyloxy-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-3-pyridinyl] 2-hydroxyethyl carbonate.
What is the SMILES notation for [5-ethoxycarbonyloxy-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-3-pyridinyl] 2-hydroxyethyl carbonate?
The canonical SMILES for [5-ethoxycarbonyloxy-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-3-pyridinyl] 2-hydroxyethyl carbonate is CCOC(=O)Oc1c(C)nc(C)c(OC(=O)OCCO)c1-c1ccccc1C(F)(F)F.
What is the InChIKey of [5-ethoxycarbonyloxy-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-3-pyridinyl] 2-hydroxyethyl carbonate?
The InChIKey is AHTIEQSDRRKZOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20F3NO7/c1-4-28-18(26)30-16-11(2)24-12(3)17(31-19(27)29-10-9-25)15(16)13-7-5-6-8-14(13)20(21,22)23/h5-8,25H,4,9-10H2,1-3H3.
What are the key properties of [5-ethoxycarbonyloxy-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-3-pyridinyl] 2-hydroxyethyl carbonate?
[5-ethoxycarbonyloxy-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-3-pyridinyl] 2-hydroxyethyl carbonate has a molecular weight of 443.37 g/mol, XLogP of 4.43, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [5-ethoxycarbonyloxy-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-3-pyridinyl] 2-hydroxyethyl carbonate is sourced from PubChem (CID 70474794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).