C23H27N2O+ — CID 7047484
(5R)-4-benzyl-12-(methoxymethyl)-1-aza-4-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene (PubChem CID 7047484) has the molecular formula C23H27N2O+ and a molecular weight of 347.48 g/mol. Its IUPAC name is (5R)-4-benzyl-12-(methoxymethyl)-1-aza-4-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene.
| Compound Name | (5R)-4-benzyl-12-(methoxymethyl)-1-aza-4-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene |
|---|---|
| PubChem CID | 7047484 |
| Molecular Formula | C23H27N2O+ |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | (5R)-4-benzyl-12-(methoxymethyl)-1-aza-4-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene |
| SMILES | COCc1ccc2c(c1)c1c3n2CC[NH+](Cc2ccccc2)[C@@H]3CCC1 |
| InChI | InChI=1S/C23H26N2O/c1-26-16-18-10-11-21-20(14-18)19-8-5-9-22-23(19)25(21)13-12-24(22)15-17-6-3-2-4-7-17/h2-4,6-7,10-11,14,22H,5,8-9,12-13,15-16H2,1H3/p+1/t22-/m1/s1 |
| InChIKey | XXNVNCLJWPPPSH-JOCHJYFZSA-O |
| XLogP | 3.26 |
| TPSA | 18.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|