C16H20F3N7 — CID 70474860
1-[2-[4-(5-methylpyrimidin-2-yl)butyl]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine (PubChem CID 70474860) has the molecular formula C16H20F3N7 and a molecular weight of 367.38 g/mol. Its IUPAC name is 1-[2-[4-(5-methylpyrimidin-2-yl)butyl]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 1-[2-[4-(5-methylpyrimidin-2-yl)butyl]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 70474860 |
| Molecular Formula | C16H20F3N7 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 1-[2-[4-(5-methylpyrimidin-2-yl)butyl]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine |
| SMILES | Cc1cnc(CCCCc2nccc(N/C(N)=N/CC(F)(F)F)n2)nc1 |
| InChI | InChI=1S/C16H20F3N7/c1-11-8-22-12(23-9-11)4-2-3-5-13-21-7-6-14(25-13)26-15(20)24-10-16(17,18)19/h6-9H,2-5,10H2,1H3,(H3,20,21,24,25,26) |
| InChIKey | HTTQUICSRGBVPO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 101.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|