About [4-(2,4-dimethylphenyl)thiolan-2-yl]methanol
[4-(2,4-dimethylphenyl)thiolan-2-yl]methanol (PubChem CID 70474892) has the molecular formula C13H18OS
and a molecular weight of 222.35 g/mol. Its IUPAC name is [4-(2,4-dimethylphenyl)thiolan-2-yl]methanol.
Molecular Properties
| Compound Name | [4-(2,4-dimethylphenyl)thiolan-2-yl]methanol |
| PubChem CID | 70474892 |
| Molecular Formula | C13H18OS |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | [4-(2,4-dimethylphenyl)thiolan-2-yl]methanol |
| SMILES | Cc1ccc(C2CSC(CO)C2)c(C)c1 |
| InChI | InChI=1S/C13H18OS/c1-9-3-4-13(10(2)5-9)11-6-12(7-14)15-8-11/h3-5,11-12,14H,6-8H2,1-2H3 |
| InChIKey | KLDNSWJWWFHCGL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [4-(2,4-dimethylphenyl)thiolan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,4-dimethylphenyl)thiolan-2-yl]methanol?
The IUPAC name of [4-(2,4-dimethylphenyl)thiolan-2-yl]methanol (CID 70474892) is [4-(2,4-dimethylphenyl)thiolan-2-yl]methanol.
What is the SMILES notation for [4-(2,4-dimethylphenyl)thiolan-2-yl]methanol?
The canonical SMILES for [4-(2,4-dimethylphenyl)thiolan-2-yl]methanol is Cc1ccc(C2CSC(CO)C2)c(C)c1.
What is the InChIKey of [4-(2,4-dimethylphenyl)thiolan-2-yl]methanol?
The InChIKey is KLDNSWJWWFHCGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18OS/c1-9-3-4-13(10(2)5-9)11-6-12(7-14)15-8-11/h3-5,11-12,14H,6-8H2,1-2H3.
What are the key properties of [4-(2,4-dimethylphenyl)thiolan-2-yl]methanol?
[4-(2,4-dimethylphenyl)thiolan-2-yl]methanol has a molecular weight of 222.35 g/mol, XLogP of 2.88, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,4-dimethylphenyl)thiolan-2-yl]methanol is sourced from PubChem (CID 70474892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).