C18H25NO5 — CID 70474896
2-[4-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylamino]phenyl]-2-ethyl-3-oxobutanoic acid (PubChem CID 70474896) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-[4-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylamino]phenyl]-2-ethyl-3-oxobutanoic acid.
| Compound Name | 2-[4-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylamino]phenyl]-2-ethyl-3-oxobutanoic acid |
|---|---|
| PubChem CID | 70474896 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 2-[4-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylamino]phenyl]-2-ethyl-3-oxobutanoic acid |
| SMILES | CCC(C(C)=O)(C(=O)O)c1ccc(NCC2COC(C)(C)O2)cc1 |
| InChI | InChI=1S/C18H25NO5/c1-5-18(12(2)20,16(21)22)13-6-8-14(9-7-13)19-10-15-11-23-17(3,4)24-15/h6-9,15,19H,5,10-11H2,1-4H3,(H,21,22) |
| InChIKey | NVSAJJFIRXLTLN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|