C16H19F3N6S — CID 70475146
1-[6-[3-(5-methylpyrimidin-2-yl)propylsulfanyl]-2-pyridinyl]-2-(2,2,2-trifluoroethyl)guanidine (PubChem CID 70475146) has the molecular formula C16H19F3N6S and a molecular weight of 384.43 g/mol. Its IUPAC name is 1-[6-[3-(5-methylpyrimidin-2-yl)propylsulfanyl]-2-pyridinyl]-2-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 1-[6-[3-(5-methylpyrimidin-2-yl)propylsulfanyl]-2-pyridinyl]-2-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 70475146 |
| Molecular Formula | C16H19F3N6S |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 1-[6-[3-(5-methylpyrimidin-2-yl)propylsulfanyl]-2-pyridinyl]-2-(2,2,2-trifluoroethyl)guanidine |
| SMILES | Cc1cnc(CCCSc2cccc(N/C(N)=N/CC(F)(F)F)n2)nc1 |
| InChI | InChI=1S/C16H19F3N6S/c1-11-8-21-12(22-9-11)5-3-7-26-14-6-2-4-13(24-14)25-15(20)23-10-16(17,18)19/h2,4,6,8-9H,3,5,7,10H2,1H3,(H3,20,23,24,25) |
| InChIKey | QWOXOLUJEJDKOI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 89.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|