About hydroxy-(2-methylpentylsulfanyl)-phenyl-sulfanylidene-λ5-phosphane;hydrochloride
hydroxy-(2-methylpentylsulfanyl)-phenyl-sulfanylidene-λ5-phosphane;hydrochloride (PubChem CID 70475446) has the molecular formula C12H20ClOPS2
and a molecular weight of 310.85 g/mol. Its IUPAC name is hydroxy-(2-methylpentylsulfanyl)-phenyl-sulfanylidene-λ5-phosphane;hydrochloride.
Molecular Properties
| Compound Name | hydroxy-(2-methylpentylsulfanyl)-phenyl-sulfanylidene-λ5-phosphane;hydrochloride |
| PubChem CID | 70475446 |
| Molecular Formula | C12H20ClOPS2 |
| Molecular Weight | 310.85 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | hydroxy-(2-methylpentylsulfanyl)-phenyl-sulfanylidene-λ5-phosphane;hydrochloride |
| SMILES | CCCC(C)CSP(O)(=S)c1ccccc1.Cl |
| InChI | InChI=1S/C12H19OPS2.ClH/c1-3-7-11(2)10-16-14(13,15)12-8-5-4-6-9-12;/h4-6,8-9,11H,3,7,10H2,1-2H3,(H,13,15);1H |
| InChIKey | PTNRUTSKIOSGIQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.85 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-(2-methylpentylsulfanyl)-phenyl-sulfanylidene-λ5-phosphane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-(2-methylpentylsulfanyl)-phenyl-sulfanylidene-λ5-phosphane;hydrochloride?
The IUPAC name of hydroxy-(2-methylpentylsulfanyl)-phenyl-sulfanylidene-λ5-phosphane;hydrochloride (CID 70475446) is hydroxy-(2-methylpentylsulfanyl)-phenyl-sulfanylidene-λ5-phosphane;hydrochloride.
What is the SMILES notation for hydroxy-(2-methylpentylsulfanyl)-phenyl-sulfanylidene-λ5-phosphane;hydrochloride?
The canonical SMILES for hydroxy-(2-methylpentylsulfanyl)-phenyl-sulfanylidene-λ5-phosphane;hydrochloride is CCCC(C)CSP(O)(=S)c1ccccc1.Cl.
What is the InChIKey of hydroxy-(2-methylpentylsulfanyl)-phenyl-sulfanylidene-λ5-phosphane;hydrochloride?
The InChIKey is PTNRUTSKIOSGIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19OPS2.ClH/c1-3-7-11(2)10-16-14(13,15)12-8-5-4-6-9-12;/h4-6,8-9,11H,3,7,10H2,1-2H3,(H,13,15);1H.
What are the key properties of hydroxy-(2-methylpentylsulfanyl)-phenyl-sulfanylidene-λ5-phosphane;hydrochloride?
hydroxy-(2-methylpentylsulfanyl)-phenyl-sulfanylidene-λ5-phosphane;hydrochloride has a molecular weight of 310.85 g/mol, XLogP of 4.20, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-(2-methylpentylsulfanyl)-phenyl-sulfanylidene-λ5-phosphane;hydrochloride is sourced from PubChem (CID 70475446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).