C14H15N2O2+ — CID 7047653
(1S)-1-pyridin-3-yl-1,2,3,4-tetrahydroisoquinolin-2-ium-6,7-diol (PubChem CID 7047653) has the molecular formula C14H15N2O2+ and a molecular weight of 243.29 g/mol. Its IUPAC name is (1S)-1-pyridin-3-yl-1,2,3,4-tetrahydroisoquinolin-2-ium-6,7-diol.
| Compound Name | (1S)-1-pyridin-3-yl-1,2,3,4-tetrahydroisoquinolin-2-ium-6,7-diol |
|---|---|
| PubChem CID | 7047653 |
| Molecular Formula | C14H15N2O2+ |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | (1S)-1-pyridin-3-yl-1,2,3,4-tetrahydroisoquinolin-2-ium-6,7-diol |
| SMILES | Oc1cc2c(cc1O)[C@@H](c1cccnc1)[NH2+]CC2 |
| InChI | InChI=1S/C14H14N2O2/c17-12-6-9-3-5-16-14(11(9)7-13(12)18)10-2-1-4-15-8-10/h1-2,4,6-8,14,16-18H,3,5H2/p+1/t14-/m1/s1 |
| InChIKey | INWHESSIQOIMBL-CQSZACIVSA-O |
| XLogP | 0.70 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|