C14H18O2 — CID 70476568
10-hydroxy-2,3,4,4a,8a,9a,10,10a-octahydro-1H-anthracen-9-one (PubChem CID 70476568) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 10-hydroxy-2,3,4,4a,8a,9a,10,10a-octahydro-1H-anthracen-9-one.
| Compound Name | 10-hydroxy-2,3,4,4a,8a,9a,10,10a-octahydro-1H-anthracen-9-one |
|---|---|
| PubChem CID | 70476568 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 10-hydroxy-2,3,4,4a,8a,9a,10,10a-octahydro-1H-anthracen-9-one |
| SMILES | O=C1C2C=CC=CC2C(O)C2CCCCC12 |
| InChI | InChI=1S/C14H18O2/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h1-2,5-6,9-13,15H,3-4,7-8H2 |
| InChIKey | QKWYREPLGZKNKL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |