About 1-butyl-2-ethenylpyridin-1-ium;methanol;iodide
1-butyl-2-ethenylpyridin-1-ium;methanol;iodide (PubChem CID 70476767) has the molecular formula C12H20INO
and a molecular weight of 321.20 g/mol. Its IUPAC name is 1-butyl-2-ethenylpyridin-1-ium;methanol;iodide.
Molecular Properties
| Compound Name | 1-butyl-2-ethenylpyridin-1-ium;methanol;iodide |
| PubChem CID | 70476767 |
| Molecular Formula | C12H20INO |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 1-butyl-2-ethenylpyridin-1-ium;methanol;iodide |
| SMILES | C=Cc1cccc[n+]1CCCC.CO.[I-] |
| InChI | InChI=1S/C11H16N.CH4O.HI/c1-3-5-9-12-10-7-6-8-11(12)4-2;1-2;/h4,6-8,10H,2-3,5,9H2,1H3;2H,1H3;1H/q+1;;/p-1 |
| InChIKey | ICWKUHRSDXINAN-UHFFFAOYSA-M |
| XLogP | -0.97 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-2-ethenylpyridin-1-ium;methanol;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2-ethenylpyridin-1-ium;methanol;iodide?
The IUPAC name of 1-butyl-2-ethenylpyridin-1-ium;methanol;iodide (CID 70476767) is 1-butyl-2-ethenylpyridin-1-ium;methanol;iodide.
What is the SMILES notation for 1-butyl-2-ethenylpyridin-1-ium;methanol;iodide?
The canonical SMILES for 1-butyl-2-ethenylpyridin-1-ium;methanol;iodide is C=Cc1cccc[n+]1CCCC.CO.[I-].
What is the InChIKey of 1-butyl-2-ethenylpyridin-1-ium;methanol;iodide?
The InChIKey is ICWKUHRSDXINAN-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H16N.CH4O.HI/c1-3-5-9-12-10-7-6-8-11(12)4-2;1-2;/h4,6-8,10H,2-3,5,9H2,1H3;2H,1H3;1H/q+1;;/p-1.
What are the key properties of 1-butyl-2-ethenylpyridin-1-ium;methanol;iodide?
1-butyl-2-ethenylpyridin-1-ium;methanol;iodide has a molecular weight of 321.20 g/mol, XLogP of -0.97, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2-ethenylpyridin-1-ium;methanol;iodide is sourced from PubChem (CID 70476767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).