C23H25FO3S — CID 70477075
4-[(E)-1-fluoro-2-(4,4,7-trimethyl-2,3-dihydrothiochromen-6-yl)prop-1-enyl]-3-methoxybenzoic acid (PubChem CID 70477075) has the molecular formula C23H25FO3S and a molecular weight of 400.52 g/mol. Its IUPAC name is 4-[(E)-1-fluoro-2-(4,4,7-trimethyl-2,3-dihydrothiochromen-6-yl)prop-1-enyl]-3-methoxybenzoic acid.
| Compound Name | 4-[(E)-1-fluoro-2-(4,4,7-trimethyl-2,3-dihydrothiochromen-6-yl)prop-1-enyl]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 70477075 |
| Molecular Formula | C23H25FO3S |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 4-[(E)-1-fluoro-2-(4,4,7-trimethyl-2,3-dihydrothiochromen-6-yl)prop-1-enyl]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1/C(F)=C(/C)c1cc2c(cc1C)SCCC2(C)C |
| InChI | InChI=1S/C23H25FO3S/c1-13-10-20-18(23(3,4)8-9-28-20)12-17(13)14(2)21(24)16-7-6-15(22(25)26)11-19(16)27-5/h6-7,10-12H,8-9H2,1-5H3,(H,25,26)/b21-14+ |
| InChIKey | OTCILQPVYHJGQG-KGENOOAVSA-N |
| XLogP | 6.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|