C43H38F2O6 — CID 70477204
4-[(1E,5E)-6-(4-carboxy-2-methoxyphenyl)-1,6-difluoro-2,5-bis(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)hexa-1,5-dienyl]-3-hydroxybenzoic acid (PubChem CID 70477204) has the molecular formula C43H38F2O6 and a molecular weight of 688.77 g/mol. Its IUPAC name is 4-[(1E,5E)-6-(4-carboxy-2-methoxyphenyl)-1,6-difluoro-2,5-bis(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)hexa-1,5-dienyl]-3-hydroxybenzoic acid.
| Compound Name | 4-[(1E,5E)-6-(4-carboxy-2-methoxyphenyl)-1,6-difluoro-2,5-bis(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)hexa-1,5-dienyl]-3-hydroxybenzoic acid |
|---|---|
| PubChem CID | 70477204 |
| Molecular Formula | C43H38F2O6 |
| Molecular Weight | 688.77 g/mol |
| Exact Mass | 688.26 |
| IUPAC Name | 4-[(1E,5E)-6-(4-carboxy-2-methoxyphenyl)-1,6-difluoro-2,5-bis(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)hexa-1,5-dienyl]-3-hydroxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1/C(F)=C(/CC/C(=C(\F)c1ccc(C(=O)O)cc1O)c1ccc2c(c1)C1CCC2C1)c1ccc2c(c1)C1CCC2C1 |
| InChI | InChI=1S/C43H38F2O6/c1-51-39-21-29(43(49)50)9-13-35(39)41(45)33(27-7-11-31-23-3-5-25(17-23)37(31)19-27)15-14-32(40(44)34-12-8-28(42(47)48)20-38(34)46)26-6-10-30-22-2-4-24(16-22)36(30)18-26/h6-13,18-25,46H,2-5,14-17H2,1H3,(H,47,48)(H,49,50)/b40-32+,41-33+ |
| InChIKey | DWHIIYZNJKRDLE-PVKBSXSMSA-N |
| XLogP | 10.68 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.77 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|