C27H26O6 — CID 70477233
(1S,2R,3S)-1-[(3R)-2-benzylidene-3-hydroxy-4-phenyloxetan-3-yl]-5-phenylpent-4-ene-1,2,3,4-tetrol (PubChem CID 70477233) has the molecular formula C27H26O6 and a molecular weight of 446.50 g/mol. Its IUPAC name is (1S,2R,3S)-1-[(3R)-2-benzylidene-3-hydroxy-4-phenyloxetan-3-yl]-5-phenylpent-4-ene-1,2,3,4-tetrol.
| Compound Name | (1S,2R,3S)-1-[(3R)-2-benzylidene-3-hydroxy-4-phenyloxetan-3-yl]-5-phenylpent-4-ene-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 70477233 |
| Molecular Formula | C27H26O6 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | (1S,2R,3S)-1-[(3R)-2-benzylidene-3-hydroxy-4-phenyloxetan-3-yl]-5-phenylpent-4-ene-1,2,3,4-tetrol |
| SMILES | OC(=Cc1ccccc1)[C@@H](O)[C@@H](O)[C@H](O)[C@]1(O)C(=Cc2ccccc2)OC1c1ccccc1 |
| InChI | InChI=1S/C27H26O6/c28-21(16-18-10-4-1-5-11-18)23(29)24(30)25(31)27(32)22(17-19-12-6-2-7-13-19)33-26(27)20-14-8-3-9-15-20/h1-17,23-26,28-32H/t23-,24-,25+,26?,27-/m1/s1 |
| InChIKey | MKVTTXNCDPBPRH-CMLBZCPWSA-N |
| XLogP | 3.21 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|