About 2-[[(2S)-3,4-dimethyloxan-2-yl]methoxy]-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane
2-[[(2S)-3,4-dimethyloxan-2-yl]methoxy]-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane (PubChem CID 70477883) has the molecular formula C18H32O3
and a molecular weight of 296.45 g/mol. Its IUPAC name is 2-[[(2S)-3,4-dimethyloxan-2-yl]methoxy]-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | 2-[[(2S)-3,4-dimethyloxan-2-yl]methoxy]-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane |
| PubChem CID | 70477883 |
| Molecular Formula | C18H32O3 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.24 |
| IUPAC Name | 2-[[(2S)-3,4-dimethyloxan-2-yl]methoxy]-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane |
| SMILES | CC1CCO[C@H](COC2CC3(C(C)C)CCC2(C)O3)C1C |
| InChI | InChI=1S/C18H32O3/c1-12(2)18-8-7-17(5,21-18)16(10-18)20-11-15-14(4)13(3)6-9-19-15/h12-16H,6-11H2,1-5H3/t13?,14?,15-,16?,17?,18?/m1/s1 |
| InChIKey | KCWAXPDAVBCAMJ-NGBNYADNSA-N |
| XLogP | 3.80 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[(2S)-3,4-dimethyloxan-2-yl]methoxy]-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2S)-3,4-dimethyloxan-2-yl]methoxy]-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane?
The IUPAC name of 2-[[(2S)-3,4-dimethyloxan-2-yl]methoxy]-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane (CID 70477883) is 2-[[(2S)-3,4-dimethyloxan-2-yl]methoxy]-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane.
What is the SMILES notation for 2-[[(2S)-3,4-dimethyloxan-2-yl]methoxy]-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane?
The canonical SMILES for 2-[[(2S)-3,4-dimethyloxan-2-yl]methoxy]-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane is CC1CCO[C@H](COC2CC3(C(C)C)CCC2(C)O3)C1C.
What is the InChIKey of 2-[[(2S)-3,4-dimethyloxan-2-yl]methoxy]-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane?
The InChIKey is KCWAXPDAVBCAMJ-NGBNYADNSA-N. The full InChI is InChI=1S/C18H32O3/c1-12(2)18-8-7-17(5,21-18)16(10-18)20-11-15-14(4)13(3)6-9-19-15/h12-16H,6-11H2,1-5H3/t13?,14?,15-,16?,17?,18?/m1/s1.
What are the key properties of 2-[[(2S)-3,4-dimethyloxan-2-yl]methoxy]-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane?
2-[[(2S)-3,4-dimethyloxan-2-yl]methoxy]-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane has a molecular weight of 296.45 g/mol, XLogP of 3.80, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2S)-3,4-dimethyloxan-2-yl]methoxy]-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane is sourced from PubChem (CID 70477883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).