C12H17N5O6S2 — CID 70477919
4-[(1R)-2-amino-1-hydroxyethyl]benzene-1,2-diol;N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 70477919) has the molecular formula C12H17N5O6S2 and a molecular weight of 391.43 g/mol. Its IUPAC name is 4-[(1R)-2-amino-1-hydroxyethyl]benzene-1,2-diol;N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 4-[(1R)-2-amino-1-hydroxyethyl]benzene-1,2-diol;N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 70477919 |
| Molecular Formula | C12H17N5O6S2 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 4-[(1R)-2-amino-1-hydroxyethyl]benzene-1,2-diol;N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CC(=O)Nc1nnc(S(N)(=O)=O)s1.NC[C@H](O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C8H11NO3.C4H6N4O3S2/c9-4-8(12)5-1-2-6(10)7(11)3-5;1-2(9)6-3-7-8-4(12-3)13(5,10)11/h1-3,8,10-12H,4,9H2;1H3,(H2,5,10,11)(H,6,7,9)/t8-;/m0./s1 |
| InChIKey | OMHOASBHXHYJPH-QRPNPIFTSA-N |
| XLogP | -0.77 |
| TPSA | 201.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|