C38H34B2O12 — CID 70478526
[(1S,3S)-5,12-diacetyloxy-3-(1-acetyloxyethyl)-3-[hydroxy(phenyl)boranyl]oxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy-phenylborinic acid (PubChem CID 70478526) has the molecular formula C38H34B2O12 and a molecular weight of 704.30 g/mol. Its IUPAC name is [(1S,3S)-5,12-diacetyloxy-3-(1-acetyloxyethyl)-3-[hydroxy(phenyl)boranyl]oxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy-phenylborinic acid.
| Compound Name | [(1S,3S)-5,12-diacetyloxy-3-(1-acetyloxyethyl)-3-[hydroxy(phenyl)boranyl]oxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy-phenylborinic acid |
|---|---|
| PubChem CID | 70478526 |
| Molecular Formula | C38H34B2O12 |
| Molecular Weight | 704.30 g/mol |
| Exact Mass | 704.22 |
| IUPAC Name | [(1S,3S)-5,12-diacetyloxy-3-(1-acetyloxyethyl)-3-[hydroxy(phenyl)boranyl]oxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy-phenylborinic acid |
| SMILES | CC(=O)Oc1c2c(c(OC(C)=O)c3c1C(=O)c1ccccc1C3=O)[C@@H](OB(O)c1ccccc1)C[C@](OB(O)c1ccccc1)(C(C)OC(C)=O)C2 |
| InChI | InChI=1S/C38H34B2O12/c1-21(48-22(2)41)38(52-40(47)26-15-9-6-10-16-26)19-29-31(30(20-38)51-39(46)25-13-7-5-8-14-25)37(50-24(4)43)33-32(36(29)49-23(3)42)34(44)27-17-11-12-18-28(27)35(33)45/h5-18,21,30,46-47H,19-20H2,1-4H3/t21?,30-,38-/m0/s1 |
| InChIKey | JTEALOOYKMKOJG-PPTYFTENSA-N |
| XLogP | 2.80 |
| TPSA | 171.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|