About isoindole-1,3-dione;naphthalene-1,4-dione
isoindole-1,3-dione;naphthalene-1,4-dione (PubChem CID 70478975) has the molecular formula C18H11NO4
and a molecular weight of 305.29 g/mol. Its IUPAC name is isoindole-1,3-dione;naphthalene-1,4-dione.
Molecular Properties
| Compound Name | isoindole-1,3-dione;naphthalene-1,4-dione |
| PubChem CID | 70478975 |
| Molecular Formula | C18H11NO4 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | isoindole-1,3-dione;naphthalene-1,4-dione |
| SMILES | O=C1C=CC(=O)c2ccccc21.O=C1NC(=O)c2ccccc21 |
| InChI | InChI=1S/C10H6O2.C8H5NO2/c11-9-5-6-10(12)8-4-2-1-3-7(8)9;10-7-5-3-1-2-4-6(5)8(11)9-7/h1-6H;1-4H,(H,9,10,11) |
| InChIKey | CZGUFAYHIPXQNT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze isoindole-1,3-dione;naphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isoindole-1,3-dione;naphthalene-1,4-dione?
The IUPAC name of isoindole-1,3-dione;naphthalene-1,4-dione (CID 70478975) is isoindole-1,3-dione;naphthalene-1,4-dione.
What is the SMILES notation for isoindole-1,3-dione;naphthalene-1,4-dione?
The canonical SMILES for isoindole-1,3-dione;naphthalene-1,4-dione is O=C1C=CC(=O)c2ccccc21.O=C1NC(=O)c2ccccc21.
What is the InChIKey of isoindole-1,3-dione;naphthalene-1,4-dione?
The InChIKey is CZGUFAYHIPXQNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6O2.C8H5NO2/c11-9-5-6-10(12)8-4-2-1-3-7(8)9;10-7-5-3-1-2-4-6(5)8(11)9-7/h1-6H;1-4H,(H,9,10,11).
What are the key properties of isoindole-1,3-dione;naphthalene-1,4-dione?
isoindole-1,3-dione;naphthalene-1,4-dione has a molecular weight of 305.29 g/mol, XLogP of 2.19, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for isoindole-1,3-dione;naphthalene-1,4-dione is sourced from PubChem (CID 70478975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).