C13H19N3 — CID 70479212
1-prop-2-enyl-2,3,3a,4,4a,5,6,7-octahydropyrazolo[3,4-g]quinoline (PubChem CID 70479212) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 1-prop-2-enyl-2,3,3a,4,4a,5,6,7-octahydropyrazolo[3,4-g]quinoline.
| Compound Name | 1-prop-2-enyl-2,3,3a,4,4a,5,6,7-octahydropyrazolo[3,4-g]quinoline |
|---|---|
| PubChem CID | 70479212 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 1-prop-2-enyl-2,3,3a,4,4a,5,6,7-octahydropyrazolo[3,4-g]quinoline |
| SMILES | C=CCN1NCC2CC3NCCC=C3C=C21 |
| InChI | InChI=1S/C13H19N3/c1-2-6-16-13-8-10-4-3-5-14-12(10)7-11(13)9-15-16/h2,4,8,11-12,14-15H,1,3,5-7,9H2 |
| InChIKey | UVJITAJEJJSKFQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|