C20H28FN7 — CID 70479463
6-N-[2-[ethyl-[(4-fluorophenyl)methyl]amino]ethyl]-2-N,4-N-bis(prop-2-enyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 70479463) has the molecular formula C20H28FN7 and a molecular weight of 385.49 g/mol. Its IUPAC name is 6-N-[2-[ethyl-[(4-fluorophenyl)methyl]amino]ethyl]-2-N,4-N-bis(prop-2-enyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-[2-[ethyl-[(4-fluorophenyl)methyl]amino]ethyl]-2-N,4-N-bis(prop-2-enyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 70479463 |
| Molecular Formula | C20H28FN7 |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 6-N-[2-[ethyl-[(4-fluorophenyl)methyl]amino]ethyl]-2-N,4-N-bis(prop-2-enyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | C=CCNc1nc(NCC=C)nc(NCCN(CC)Cc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C20H28FN7/c1-4-11-22-18-25-19(23-12-5-2)27-20(26-18)24-13-14-28(6-3)15-16-7-9-17(21)10-8-16/h4-5,7-10H,1-2,6,11-15H2,3H3,(H3,22,23,24,25,26,27) |
| InChIKey | LPXSFBFISWSSOH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|