C11H15FN+ — CID 7047956
(2R)-2-[(2-fluorophenyl)methyl]pyrrolidin-1-ium (PubChem CID 7047956) has the molecular formula C11H15FN+ and a molecular weight of 180.25 g/mol. Its IUPAC name is (2R)-2-[(2-fluorophenyl)methyl]pyrrolidin-1-ium.
| Compound Name | (2R)-2-[(2-fluorophenyl)methyl]pyrrolidin-1-ium |
|---|---|
| PubChem CID | 7047956 |
| Molecular Formula | C11H15FN+ |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (2R)-2-[(2-fluorophenyl)methyl]pyrrolidin-1-ium |
| SMILES | Fc1ccccc1C[C@H]1CCC[NH2+]1 |
| InChI | InChI=1S/C11H14FN/c12-11-6-2-1-4-9(11)8-10-5-3-7-13-10/h1-2,4,6,10,13H,3,5,7-8H2/p+1/t10-/m1/s1 |
| InChIKey | QCUXMVRXZZBSCE-SNVBAGLBSA-O |
| XLogP | 1.09 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |