About bis(6,7,8-trimethoxy-2-piperazin-1-ylquinazolin-4-amine);hydrate
bis(6,7,8-trimethoxy-2-piperazin-1-ylquinazolin-4-amine);hydrate (PubChem CID 70479861) has the molecular formula C30H44N10O7
and a molecular weight of 656.75 g/mol. Its IUPAC name is bis(6,7,8-trimethoxy-2-piperazin-1-ylquinazolin-4-amine);hydrate.
Molecular Properties
| Compound Name | bis(6,7,8-trimethoxy-2-piperazin-1-ylquinazolin-4-amine);hydrate |
| PubChem CID | 70479861 |
| Molecular Formula | C30H44N10O7 |
| Molecular Weight | 656.75 g/mol |
| Exact Mass | 656.34 |
| IUPAC Name | bis(6,7,8-trimethoxy-2-piperazin-1-ylquinazolin-4-amine);hydrate |
| SMILES | COc1cc2c(N)nc(N3CCNCC3)nc2c(OC)c1OC.COc1cc2c(N)nc(N3CCNCC3)nc2c(OC)c1OC.O |
| InChI | InChI=1S/2C15H21N5O3.H2O/c2*1-21-10-8-9-11(13(23-3)12(10)22-2)18-15(19-14(9)16)20-6-4-17-5-7-20;/h2*8,17H,4-7H2,1-3H3,(H2,16,18,19);1H2 |
| InChIKey | UBVLNVVDOKHFEH-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 221.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 656.75 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
Analyze bis(6,7,8-trimethoxy-2-piperazin-1-ylquinazolin-4-amine);hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(6,7,8-trimethoxy-2-piperazin-1-ylquinazolin-4-amine);hydrate?
The IUPAC name of bis(6,7,8-trimethoxy-2-piperazin-1-ylquinazolin-4-amine);hydrate (CID 70479861) is bis(6,7,8-trimethoxy-2-piperazin-1-ylquinazolin-4-amine);hydrate.
What is the SMILES notation for bis(6,7,8-trimethoxy-2-piperazin-1-ylquinazolin-4-amine);hydrate?
The canonical SMILES for bis(6,7,8-trimethoxy-2-piperazin-1-ylquinazolin-4-amine);hydrate is COc1cc2c(N)nc(N3CCNCC3)nc2c(OC)c1OC.COc1cc2c(N)nc(N3CCNCC3)nc2c(OC)c1OC.O.
What is the InChIKey of bis(6,7,8-trimethoxy-2-piperazin-1-ylquinazolin-4-amine);hydrate?
The InChIKey is UBVLNVVDOKHFEH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C15H21N5O3.H2O/c2*1-21-10-8-9-11(13(23-3)12(10)22-2)18-15(19-14(9)16)20-6-4-17-5-7-20;/h2*8,17H,4-7H2,1-3H3,(H2,16,18,19);1H2.
What are the key properties of bis(6,7,8-trimethoxy-2-piperazin-1-ylquinazolin-4-amine);hydrate?
bis(6,7,8-trimethoxy-2-piperazin-1-ylquinazolin-4-amine);hydrate has a molecular weight of 656.75 g/mol, XLogP of 0.47, 8 rotatable bonds, 4 hydrogen bond donors, and 16 hydrogen bond acceptors.
Where does this data come from?
All data for bis(6,7,8-trimethoxy-2-piperazin-1-ylquinazolin-4-amine);hydrate is sourced from PubChem (CID 70479861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).